C20H43NO6P+ — CID 173331974
[3-carboxy-2-[hydroxy(8-pentoxyoctoxy)phosphanyl]oxypropyl]-trimethylazanium (PubChem CID 173331974) has the molecular formula C20H43NO6P+ and a molecular weight of 424.54 g/mol. Its IUPAC name is [3-carboxy-2-[hydroxy(8-pentoxyoctoxy)phosphanyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[hydroxy(8-pentoxyoctoxy)phosphanyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 173331974 |
| Molecular Formula | C20H43NO6P+ |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | [3-carboxy-2-[hydroxy(8-pentoxyoctoxy)phosphanyl]oxypropyl]-trimethylazanium |
| SMILES | CCCCCOCCCCCCCCO[P@](O)OC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C20H42NO6P/c1-5-6-11-14-25-15-12-9-7-8-10-13-16-26-28(24)27-19(17-20(22)23)18-21(2,3)4/h19,24H,5-18H2,1-4H3/p+1/t19?,28-/m0/s1 |
| InChIKey | PAUOWMRBHVXLDI-JEBGQCBNSA-O |
| XLogP | 4.34 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|