C22H47NO6P+ — CID 173332015
[3-carboxy-2-[hydroxy-[9-(2-methylpentan-2-yloxy)nonoxy]phosphanyl]oxypropyl]-trimethylazanium (PubChem CID 173332015) has the molecular formula C22H47NO6P+ and a molecular weight of 452.59 g/mol. Its IUPAC name is [3-carboxy-2-[hydroxy-[9-(2-methylpentan-2-yloxy)nonoxy]phosphanyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[hydroxy-[9-(2-methylpentan-2-yloxy)nonoxy]phosphanyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 173332015 |
| Molecular Formula | C22H47NO6P+ |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | [3-carboxy-2-[hydroxy-[9-(2-methylpentan-2-yloxy)nonoxy]phosphanyl]oxypropyl]-trimethylazanium |
| SMILES | CCCC(C)(C)OCCCCCCCCCO[P@](O)OC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C22H46NO6P/c1-7-15-22(2,3)27-16-13-11-9-8-10-12-14-17-28-30(26)29-20(18-21(24)25)19-23(4,5)6/h20,26H,7-19H2,1-6H3/p+1/t20?,30-/m0/s1 |
| InChIKey | BCCSOBCMIYGQKM-QOWRFBDLSA-O |
| XLogP | 5.11 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|