C16H27NO4Si — CID 173332614
(3R,4R,5S)-2-(hydroxymethyl)-1-[(2-trimethylsilylphenyl)methyl]piperidine-3,4,5-triol (PubChem CID 173332614) has the molecular formula C16H27NO4Si and a molecular weight of 325.48 g/mol. Its IUPAC name is (3R,4R,5S)-2-(hydroxymethyl)-1-[(2-trimethylsilylphenyl)methyl]piperidine-3,4,5-triol.
| Compound Name | (3R,4R,5S)-2-(hydroxymethyl)-1-[(2-trimethylsilylphenyl)methyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 173332614 |
| Molecular Formula | C16H27NO4Si |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (3R,4R,5S)-2-(hydroxymethyl)-1-[(2-trimethylsilylphenyl)methyl]piperidine-3,4,5-triol |
| SMILES | C[Si](C)(C)c1ccccc1CN1C[C@H](O)[C@@H](O)[C@H](O)C1CO |
| InChI | InChI=1S/C16H27NO4Si/c1-22(2,3)14-7-5-4-6-11(14)8-17-9-13(19)16(21)15(20)12(17)10-18/h4-7,12-13,15-16,18-21H,8-10H2,1-3H3/t12?,13-,15+,16+/m0/s1 |
| InChIKey | VGIFLHFJUSALIL-CCQOOCRRSA-N |
| XLogP | -0.51 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|