C24H46O4Si — CID 173336517
2-[3-(3-tert-butyl-10-dimethylsilyloxydec-1-enyl)-1-hydroxycyclohexyl]acetic acid (PubChem CID 173336517) has the molecular formula C24H46O4Si and a molecular weight of 426.71 g/mol. Its IUPAC name is 2-[3-(3-tert-butyl-10-dimethylsilyloxydec-1-enyl)-1-hydroxycyclohexyl]acetic acid.
| Compound Name | 2-[3-(3-tert-butyl-10-dimethylsilyloxydec-1-enyl)-1-hydroxycyclohexyl]acetic acid |
|---|---|
| PubChem CID | 173336517 |
| Molecular Formula | C24H46O4Si |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | 2-[3-(3-tert-butyl-10-dimethylsilyloxydec-1-enyl)-1-hydroxycyclohexyl]acetic acid |
| SMILES | C[SiH](C)OCCCCCCCC(C=CC1CCCC(O)(CC(=O)O)C1)C(C)(C)C |
| InChI | InChI=1S/C24H46O4Si/c1-23(2,3)21(13-9-7-6-8-10-17-28-29(4)5)15-14-20-12-11-16-24(27,18-20)19-22(25)26/h14-15,20-21,27,29H,6-13,16-19H2,1-5H3,(H,25,26) |
| InChIKey | USCBFOSHRHRRRJ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|