C15H19NO2 — CID 173344567
4-(2-methoxybutyl)-2-(4-methylphenyl)-1,3-oxazole (PubChem CID 173344567) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 4-(2-methoxybutyl)-2-(4-methylphenyl)-1,3-oxazole.
| Compound Name | 4-(2-methoxybutyl)-2-(4-methylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 173344567 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 4-(2-methoxybutyl)-2-(4-methylphenyl)-1,3-oxazole |
| SMILES | CCC(Cc1coc(-c2ccc(C)cc2)n1)OC |
| InChI | InChI=1S/C15H19NO2/c1-4-14(17-3)9-13-10-18-15(16-13)12-7-5-11(2)6-8-12/h5-8,10,14H,4,9H2,1-3H3 |
| InChIKey | FIUSRBWJWVYCTB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |