C28H30Cl2N2S — CID 173346943
4-[3-(4-benzo[c][1]benzothiepin-5-ylidenepiperidin-1-yl)prop-1-enyl]aniline;dihydrochloride (PubChem CID 173346943) has the molecular formula C28H30Cl2N2S and a molecular weight of 497.54 g/mol. Its IUPAC name is 4-[3-(4-benzo[c][1]benzothiepin-5-ylidenepiperidin-1-yl)prop-1-enyl]aniline;dihydrochloride.
| Compound Name | 4-[3-(4-benzo[c][1]benzothiepin-5-ylidenepiperidin-1-yl)prop-1-enyl]aniline;dihydrochloride |
|---|---|
| PubChem CID | 173346943 |
| Molecular Formula | C28H30Cl2N2S |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 4-[3-(4-benzo[c][1]benzothiepin-5-ylidenepiperidin-1-yl)prop-1-enyl]aniline;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(C=CCN2CCC(=S3C=c4ccccc4=Cc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C28H28N2S.2ClH/c29-26-13-11-22(12-14-26)6-5-17-30-18-15-27(16-19-30)31-21-25-9-2-1-7-23(25)20-24-8-3-4-10-28(24)31;;/h1-14,20-21H,15-19,29H2;2*1H |
| InChIKey | HPMSAKKMRNLUSN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|