C21H22F3N3O4 — CID 173348251
10-[(4-methoxyphenyl)methylamino]-7-methyl-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,9-trien-11-one;2,2,2-trifluoroacetic acid (PubChem CID 173348251) has the molecular formula C21H22F3N3O4 and a molecular weight of 437.42 g/mol. Its IUPAC name is 10-[(4-methoxyphenyl)methylamino]-7-methyl-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,9-trien-11-one;2,2,2-trifluoroacetic acid.
| Compound Name | 10-[(4-methoxyphenyl)methylamino]-7-methyl-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,9-trien-11-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 173348251 |
| Molecular Formula | C21H22F3N3O4 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 10-[(4-methoxyphenyl)methylamino]-7-methyl-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,9-trien-11-one;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(CNC2=CC3c4c(c[nH]c4C2=O)CCN3C)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H21N3O2.C2HF3O2/c1-22-8-7-13-11-21-18-17(13)16(22)9-15(19(18)23)20-10-12-3-5-14(24-2)6-4-12;3-2(4,5)1(6)7/h3-6,9,11,16,20-21H,7-8,10H2,1-2H3;(H,6,7) |
| InChIKey | JXPSHXWSRIQAKI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |