C24H18N6O4S — CID 17335165
(E)-N-[3-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17335165) has the molecular formula C24H18N6O4S and a molecular weight of 486.51 g/mol. Its IUPAC name is (E)-N-[3-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[3-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17335165 |
| Molecular Formula | C24H18N6O4S |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | (E)-N-[3-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enamide |
| SMILES | CCc1nnc2sc(-c3cccc(NC(=O)/C=C/c4ccc(-c5ccccc5[N+](=O)[O-])o4)c3)nn12 |
| InChI | InChI=1S/C24H18N6O4S/c1-2-21-26-27-24-29(21)28-23(35-24)15-6-5-7-16(14-15)25-22(31)13-11-17-10-12-20(34-17)18-8-3-4-9-19(18)30(32)33/h3-14H,2H2,1H3,(H,25,31)/b13-11+ |
| InChIKey | DTNXKVYUBSLSBF-ACCUITESSA-N |
| XLogP | 5.24 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|