C9H19NO2S — CID 173362390
(2S,4S)-5-ethylsulfanyl-3-hydroxy-4-methyl-2-(methylamino)pentanal (PubChem CID 173362390) has the molecular formula C9H19NO2S and a molecular weight of 205.32 g/mol. Its IUPAC name is (2S,4S)-5-ethylsulfanyl-3-hydroxy-4-methyl-2-(methylamino)pentanal.
| Compound Name | (2S,4S)-5-ethylsulfanyl-3-hydroxy-4-methyl-2-(methylamino)pentanal |
|---|---|
| PubChem CID | 173362390 |
| Molecular Formula | C9H19NO2S |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (2S,4S)-5-ethylsulfanyl-3-hydroxy-4-methyl-2-(methylamino)pentanal |
| SMILES | CCSC[C@@H](C)C(O)[C@@H](C=O)NC |
| InChI | InChI=1S/C9H19NO2S/c1-4-13-6-7(2)9(12)8(5-11)10-3/h5,7-10,12H,4,6H2,1-3H3/t7-,8-,9?/m1/s1 |
| InChIKey | UWNUTVFVAPVVPH-ZAZKALAHSA-N |
| XLogP | 0.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|