C8H16N2O5S — CID 87118621
O-[(2R,3S,4R,5R)-2,3,4-trihydroxy-5-(methylamino)-6-oxohexyl] carbamothioate (PubChem CID 87118621) has the molecular formula C8H16N2O5S and a molecular weight of 252.29 g/mol. Its IUPAC name is O-[(2R,3S,4R,5R)-2,3,4-trihydroxy-5-(methylamino)-6-oxohexyl] carbamothioate.
| Compound Name | O-[(2R,3S,4R,5R)-2,3,4-trihydroxy-5-(methylamino)-6-oxohexyl] carbamothioate |
|---|---|
| PubChem CID | 87118621 |
| Molecular Formula | C8H16N2O5S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | O-[(2R,3S,4R,5R)-2,3,4-trihydroxy-5-(methylamino)-6-oxohexyl] carbamothioate |
| SMILES | CN[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)COC(N)=S |
| InChI | InChI=1S/C8H16N2O5S/c1-10-4(2-11)6(13)7(14)5(12)3-15-8(9)16/h2,4-7,10,12-14H,3H2,1H3,(H2,9,16)/t4-,5+,6+,7+/m0/s1 |
| InChIKey | UKRPUROEXSGVSE-BDVNFPICSA-N |
| XLogP | -2.88 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|