C11H24NO8P — CID 87576954
[(2R,3S,4R,5R)-2,3,4-trihydroxy-6-oxo-5-(pentylamino)hexyl] dihydrogen phosphate (PubChem CID 87576954) has the molecular formula C11H24NO8P and a molecular weight of 329.29 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-2,3,4-trihydroxy-6-oxo-5-(pentylamino)hexyl] dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-2,3,4-trihydroxy-6-oxo-5-(pentylamino)hexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 87576954 |
| Molecular Formula | C11H24NO8P |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | [(2R,3S,4R,5R)-2,3,4-trihydroxy-6-oxo-5-(pentylamino)hexyl] dihydrogen phosphate |
| SMILES | CCCCCN[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C11H24NO8P/c1-2-3-4-5-12-8(6-13)10(15)11(16)9(14)7-20-21(17,18)19/h6,8-12,14-16H,2-5,7H2,1H3,(H2,17,18,19)/t8-,9+,10+,11+/m0/s1 |
| InChIKey | VUMTUAJYXPQJCX-LNFKQOIKSA-N |
| XLogP | -1.47 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|