C11H26O12P2 — CID 70689613
[(2R,3R,4S,5R)-2,3,4-trihydroxy-5-pentoxy-6-phosphonooxyhexyl] dihydrogen phosphate (PubChem CID 70689613) has the molecular formula C11H26O12P2 and a molecular weight of 412.27 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-2,3,4-trihydroxy-5-pentoxy-6-phosphonooxyhexyl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4S,5R)-2,3,4-trihydroxy-5-pentoxy-6-phosphonooxyhexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 70689613 |
| Molecular Formula | C11H26O12P2 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | [(2R,3R,4S,5R)-2,3,4-trihydroxy-5-pentoxy-6-phosphonooxyhexyl] dihydrogen phosphate |
| SMILES | CCCCCO[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C11H26O12P2/c1-2-3-4-5-21-9(7-23-25(18,19)20)11(14)10(13)8(12)6-22-24(15,16)17/h8-14H,2-7H2,1H3,(H2,15,16,17)(H2,18,19,20)/t8-,9-,10-,11-/m1/s1 |
| InChIKey | JVJACORASAJWCM-GWOFURMSSA-N |
| XLogP | -1.14 |
| TPSA | 203.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|