C11H26O12P2 — CID 70691741
[(2R)-2-hydroxy-2-[(1S,2R,3R)-1,2,3-trihydroxy-4-phosphonooxybutyl]heptyl] dihydrogen phosphate (PubChem CID 70691741) has the molecular formula C11H26O12P2 and a molecular weight of 412.27 g/mol. Its IUPAC name is [(2R)-2-hydroxy-2-[(1S,2R,3R)-1,2,3-trihydroxy-4-phosphonooxybutyl]heptyl] dihydrogen phosphate.
| Compound Name | [(2R)-2-hydroxy-2-[(1S,2R,3R)-1,2,3-trihydroxy-4-phosphonooxybutyl]heptyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 70691741 |
| Molecular Formula | C11H26O12P2 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | [(2R)-2-hydroxy-2-[(1S,2R,3R)-1,2,3-trihydroxy-4-phosphonooxybutyl]heptyl] dihydrogen phosphate |
| SMILES | CCCCC[C@@](O)(COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C11H26O12P2/c1-2-3-4-5-11(15,7-23-25(19,20)21)10(14)9(13)8(12)6-22-24(16,17)18/h8-10,12-15H,2-7H2,1H3,(H2,16,17,18)(H2,19,20,21)/t8-,9-,10+,11-/m1/s1 |
| InChIKey | GACFGVWHDZXULL-CHWFTXMASA-N |
| XLogP | -1.40 |
| TPSA | 214.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|