C16H33NOSi — CID 173363050
10-(2,6-dimethylmorpholin-4-yl)dec-2-enylsilane (PubChem CID 173363050) has the molecular formula C16H33NOSi and a molecular weight of 283.53 g/mol. Its IUPAC name is 10-(2,6-dimethylmorpholin-4-yl)dec-2-enylsilane.
| Compound Name | 10-(2,6-dimethylmorpholin-4-yl)dec-2-enylsilane |
|---|---|
| PubChem CID | 173363050 |
| Molecular Formula | C16H33NOSi |
| Molecular Weight | 283.53 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 10-(2,6-dimethylmorpholin-4-yl)dec-2-enylsilane |
| SMILES | CC1CN(CCCCCCCC=CC[SiH3])CC(C)O1 |
| InChI | InChI=1S/C16H33NOSi/c1-15-13-17(14-16(2)18-15)11-9-7-5-3-4-6-8-10-12-19/h8,10,15-16H,3-7,9,11-14H2,1-2,19H3 |
| InChIKey | REDKKNQWGPWLQK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.53 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|