C7H15NOSi — CID 173370539
N,2,3-trimethyl-N-silylbut-3-enamide (PubChem CID 173370539) has the molecular formula C7H15NOSi and a molecular weight of 157.29 g/mol. Its IUPAC name is N,2,3-trimethyl-N-silylbut-3-enamide.
| Compound Name | N,2,3-trimethyl-N-silylbut-3-enamide |
|---|---|
| PubChem CID | 173370539 |
| Molecular Formula | C7H15NOSi |
| Molecular Weight | 157.29 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | N,2,3-trimethyl-N-silylbut-3-enamide |
| SMILES | C=C(C)C(C)C(=O)N(C)[SiH3] |
| InChI | InChI=1S/C7H15NOSi/c1-5(2)6(3)7(9)8(4)10/h6H,1H2,2-4,10H3 |
| InChIKey | LHWJFCZVBBIWLF-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.29 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|