C10H26N2O2Si — CID 173372191
N'-(1-dimethoxysilylbutyl)butane-1,4-diamine (PubChem CID 173372191) has the molecular formula C10H26N2O2Si and a molecular weight of 234.42 g/mol. Its IUPAC name is N'-(1-dimethoxysilylbutyl)butane-1,4-diamine.
| Compound Name | N'-(1-dimethoxysilylbutyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 173372191 |
| Molecular Formula | C10H26N2O2Si |
| Molecular Weight | 234.42 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | N'-(1-dimethoxysilylbutyl)butane-1,4-diamine |
| SMILES | CCCC(NCCCCN)[SiH](OC)OC |
| InChI | InChI=1S/C10H26N2O2Si/c1-4-7-10(15(13-2)14-3)12-9-6-5-8-11/h10,12,15H,4-9,11H2,1-3H3 |
| InChIKey | QRUSAISMHXJZNX-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.42 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|