C10H14INO — CID 173373912
2-ethyl-2-methyl-3H-1,3-benzoxazole;hydroiodide (PubChem CID 173373912) has the molecular formula C10H14INO and a molecular weight of 291.13 g/mol. Its IUPAC name is 2-ethyl-2-methyl-3H-1,3-benzoxazole;hydroiodide.
| Compound Name | 2-ethyl-2-methyl-3H-1,3-benzoxazole;hydroiodide |
|---|---|
| PubChem CID | 173373912 |
| Molecular Formula | C10H14INO |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 2-ethyl-2-methyl-3H-1,3-benzoxazole;hydroiodide |
| SMILES | CCC1(C)Nc2ccccc2O1.I |
| InChI | InChI=1S/C10H13NO.HI/c1-3-10(2)11-8-6-4-5-7-9(8)12-10;/h4-7,11H,3H2,1-2H3;1H |
| InChIKey | QPDGQRHUTHRAJL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|