About disodium;acetate;tetrafluoroborate
disodium;acetate;tetrafluoroborate (PubChem CID 173374237) has the molecular formula C2H3BF4Na2O2
and a molecular weight of 191.83 g/mol. Its IUPAC name is disodium;acetate;tetrafluoroborate.
Molecular Properties
| Compound Name | disodium;acetate;tetrafluoroborate |
| PubChem CID | 173374237 |
| Molecular Formula | C2H3BF4Na2O2 |
| Molecular Weight | 191.83 g/mol |
| Exact Mass | 192.00 |
| IUPAC Name | disodium;acetate;tetrafluoroborate |
| SMILES | CC(=O)[O-].F[B-](F)(F)F.[Na+].[Na+] |
| InChI | InChI=1S/C2H4O2.BF4.2Na/c1-2(3)4;2-1(3,4)5;;/h1H3,(H,3,4);;;/q;-1;2*+1/p-1 |
| InChIKey | RPDGCTQCERCHJM-UHFFFAOYSA-M |
| XLogP | -5.94 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.83 |
| LogP ≤ 5 | -5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze disodium;acetate;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;acetate;tetrafluoroborate?
The IUPAC name of disodium;acetate;tetrafluoroborate (CID 173374237) is disodium;acetate;tetrafluoroborate.
What is the SMILES notation for disodium;acetate;tetrafluoroborate?
The canonical SMILES for disodium;acetate;tetrafluoroborate is CC(=O)[O-].F[B-](F)(F)F.[Na+].[Na+].
What is the InChIKey of disodium;acetate;tetrafluoroborate?
The InChIKey is RPDGCTQCERCHJM-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.BF4.2Na/c1-2(3)4;2-1(3,4)5;;/h1H3,(H,3,4);;;/q;-1;2*+1/p-1.
What are the key properties of disodium;acetate;tetrafluoroborate?
disodium;acetate;tetrafluoroborate has a molecular weight of 191.83 g/mol, XLogP of -5.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;acetate;tetrafluoroborate is sourced from PubChem (CID 173374237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).