C11H21ClN2S — CID 173375351
[(2Z)-3,7-dimethylocta-2,6-dienyl]thiourea;hydrochloride (PubChem CID 173375351) has the molecular formula C11H21ClN2S and a molecular weight of 248.82 g/mol. Its IUPAC name is [(2Z)-3,7-dimethylocta-2,6-dienyl]thiourea;hydrochloride.
| Compound Name | [(2Z)-3,7-dimethylocta-2,6-dienyl]thiourea;hydrochloride |
|---|---|
| PubChem CID | 173375351 |
| Molecular Formula | C11H21ClN2S |
| Molecular Weight | 248.82 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | [(2Z)-3,7-dimethylocta-2,6-dienyl]thiourea;hydrochloride |
| SMILES | CC(C)=CCC/C(C)=C\CNC(N)=S.Cl |
| InChI | InChI=1S/C11H20N2S.ClH/c1-9(2)5-4-6-10(3)7-8-13-11(12)14;/h5,7H,4,6,8H2,1-3H3,(H3,12,13,14);1H/b10-7-; |
| InChIKey | VSGAKEYYDWGBMH-VEZAGKLZSA-N |
| XLogP | 2.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.82 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|