About (2-chlorophenyl)sulfanyl 4-pentylbenzoate;pentahydrofluoride
(2-chlorophenyl)sulfanyl 4-pentylbenzoate;pentahydrofluoride (PubChem CID 173376100) has the molecular formula C18H24ClF5O2S
and a molecular weight of 434.90 g/mol. Its IUPAC name is (2-chlorophenyl)sulfanyl 4-pentylbenzoate;pentahydrofluoride.
Molecular Properties
| Compound Name | (2-chlorophenyl)sulfanyl 4-pentylbenzoate;pentahydrofluoride |
| PubChem CID | 173376100 |
| Molecular Formula | C18H24ClF5O2S |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | (2-chlorophenyl)sulfanyl 4-pentylbenzoate;pentahydrofluoride |
| SMILES | CCCCCc1ccc(C(=O)OSc2ccccc2Cl)cc1.F.F.F.F.F |
| InChI | InChI=1S/C18H19ClO2S.5FH/c1-2-3-4-7-14-10-12-15(13-11-14)18(20)21-22-17-9-6-5-8-16(17)19;;;;;/h5-6,8-13H,2-4,7H2,1H3;5*1H |
| InChIKey | UOBNAOZQJQYNBP-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-chlorophenyl)sulfanyl 4-pentylbenzoate;pentahydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl)sulfanyl 4-pentylbenzoate;pentahydrofluoride?
The IUPAC name of (2-chlorophenyl)sulfanyl 4-pentylbenzoate;pentahydrofluoride (CID 173376100) is (2-chlorophenyl)sulfanyl 4-pentylbenzoate;pentahydrofluoride.
What is the SMILES notation for (2-chlorophenyl)sulfanyl 4-pentylbenzoate;pentahydrofluoride?
The canonical SMILES for (2-chlorophenyl)sulfanyl 4-pentylbenzoate;pentahydrofluoride is CCCCCc1ccc(C(=O)OSc2ccccc2Cl)cc1.F.F.F.F.F.
What is the InChIKey of (2-chlorophenyl)sulfanyl 4-pentylbenzoate;pentahydrofluoride?
The InChIKey is UOBNAOZQJQYNBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClO2S.5FH/c1-2-3-4-7-14-10-12-15(13-11-14)18(20)21-22-17-9-6-5-8-16(17)19;;;;;/h5-6,8-13H,2-4,7H2,1H3;5*1H.
What are the key properties of (2-chlorophenyl)sulfanyl 4-pentylbenzoate;pentahydrofluoride?
(2-chlorophenyl)sulfanyl 4-pentylbenzoate;pentahydrofluoride has a molecular weight of 434.90 g/mol, XLogP of 6.70, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl)sulfanyl 4-pentylbenzoate;pentahydrofluoride is sourced from PubChem (CID 173376100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).