C28H32N2O4 — CID 173381498
4-[4-[(E)-2-[4-(4-ethoxycyclohexyl)phenyl]peroxyethenyl]phenoxy]benzene-1,3-diamine (PubChem CID 173381498) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is 4-[4-[(E)-2-[4-(4-ethoxycyclohexyl)phenyl]peroxyethenyl]phenoxy]benzene-1,3-diamine.
| Compound Name | 4-[4-[(E)-2-[4-(4-ethoxycyclohexyl)phenyl]peroxyethenyl]phenoxy]benzene-1,3-diamine |
|---|---|
| PubChem CID | 173381498 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 4-[4-[(E)-2-[4-(4-ethoxycyclohexyl)phenyl]peroxyethenyl]phenoxy]benzene-1,3-diamine |
| SMILES | CCOC1CCC(c2ccc(OO/C=C/c3ccc(Oc4ccc(N)cc4N)cc3)cc2)CC1 |
| InChI | InChI=1S/C28H32N2O4/c1-2-31-24-12-5-21(6-13-24)22-7-14-26(15-8-22)34-32-18-17-20-3-10-25(11-4-20)33-28-16-9-23(29)19-27(28)30/h3-4,7-11,14-19,21,24H,2,5-6,12-13,29-30H2,1H3/b18-17+ |
| InChIKey | UEHXHCBKMUNOTQ-ISLYRVAYSA-N |
| XLogP | 6.69 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|