C18H17IN4O5 — CID 173386261
N-[2-(dimethylamino)ethyl]-7-hydroxy-6-(hydroxymethylidene)-2-iodo-4,9-dioxo-10H-phenazine-1-carboxamide (PubChem CID 173386261) has the molecular formula C18H17IN4O5 and a molecular weight of 496.26 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-7-hydroxy-6-(hydroxymethylidene)-2-iodo-4,9-dioxo-10H-phenazine-1-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-7-hydroxy-6-(hydroxymethylidene)-2-iodo-4,9-dioxo-10H-phenazine-1-carboxamide |
|---|---|
| PubChem CID | 173386261 |
| Molecular Formula | C18H17IN4O5 |
| Molecular Weight | 496.26 g/mol |
| Exact Mass | 496.02 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-7-hydroxy-6-(hydroxymethylidene)-2-iodo-4,9-dioxo-10H-phenazine-1-carboxamide |
| SMILES | CN(C)CCNC(=O)c1c(I)cc(=O)c2nc3c(=CO)c(O)cc(=O)c3[nH]c12 |
| InChI | InChI=1S/C18H17IN4O5/c1-23(2)4-3-20-18(28)13-9(19)5-11(26)16-17(13)22-15-12(27)6-10(25)8(7-24)14(15)21-16/h5-7,22,24-25H,3-4H2,1-2H3,(H,20,28) |
| InChIKey | HNEFWDZVYLJPBH-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 135.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|