C19H20N4O5 — CID 135603813
(6E)-N-[2-(dimethylamino)ethyl]-7-hydroxy-6-(hydroxymethylidene)-8-methyl-4,9-dioxo-10H-phenazine-1-carboxamide (PubChem CID 135603813) has the molecular formula C19H20N4O5 and a molecular weight of 384.39 g/mol. Its IUPAC name is (6E)-N-[2-(dimethylamino)ethyl]-7-hydroxy-6-(hydroxymethylidene)-8-methyl-4,9-dioxo-10H-phenazine-1-carboxamide.
| Compound Name | (6E)-N-[2-(dimethylamino)ethyl]-7-hydroxy-6-(hydroxymethylidene)-8-methyl-4,9-dioxo-10H-phenazine-1-carboxamide |
|---|---|
| PubChem CID | 135603813 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | (6E)-N-[2-(dimethylamino)ethyl]-7-hydroxy-6-(hydroxymethylidene)-8-methyl-4,9-dioxo-10H-phenazine-1-carboxamide |
| SMILES | Cc1c(O)/c(=C/O)c2nc3c(=O)ccc(C(=O)NCCN(C)C)c3[nH]c2c1=O |
| InChI | InChI=1S/C19H20N4O5/c1-9-17(26)11(8-24)14-16(18(9)27)22-13-10(4-5-12(25)15(13)21-14)19(28)20-6-7-23(2)3/h4-5,8,22,24,26H,6-7H2,1-3H3,(H,20,28)/b11-8+ |
| InChIKey | BPJNUCGMDKQLIA-DHZHZOJOSA-N |
| XLogP | -0.24 |
| TPSA | 135.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|