C20H24N4O8S — CID 135441675
(6Z)-N-[2-(dimethylamino)ethyl]-7-hydroxy-6-(hydroxymethylidene)-8-methyl-4,9-dioxo-10H-phenazine-1-carboxamide;methanesulfonic acid (PubChem CID 135441675) has the molecular formula C20H24N4O8S and a molecular weight of 480.50 g/mol. Its IUPAC name is (6Z)-N-[2-(dimethylamino)ethyl]-7-hydroxy-6-(hydroxymethylidene)-8-methyl-4,9-dioxo-10H-phenazine-1-carboxamide;methanesulfonic acid.
| Compound Name | (6Z)-N-[2-(dimethylamino)ethyl]-7-hydroxy-6-(hydroxymethylidene)-8-methyl-4,9-dioxo-10H-phenazine-1-carboxamide;methanesulfonic acid |
|---|---|
| PubChem CID | 135441675 |
| Molecular Formula | C20H24N4O8S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | (6Z)-N-[2-(dimethylamino)ethyl]-7-hydroxy-6-(hydroxymethylidene)-8-methyl-4,9-dioxo-10H-phenazine-1-carboxamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Cc1c(O)/c(=C\O)c2nc3c(=O)ccc(C(=O)NCCN(C)C)c3[nH]c2c1=O |
| InChI | InChI=1S/C19H20N4O5.CH4O3S/c1-9-17(26)11(8-24)14-16(18(9)27)22-13-10(4-5-12(25)15(13)21-14)19(28)20-6-7-23(2)3;1-5(2,3)4/h4-5,8,22,24,26H,6-7H2,1-3H3,(H,20,28);1H3,(H,2,3,4)/b11-8-; |
| InChIKey | ORCCNZHDFHFYJP-MKFZHGHUSA-N |
| XLogP | -0.74 |
| TPSA | 189.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|