C19H13Cl2N5O3 — CID 173389699
[2-[[3-chloro-4-[1-(4-chlorophenyl)-1-cyanoethyl]phenyl]hydrazinylidene]-2-cyanoacetyl]carbamic acid (PubChem CID 173389699) has the molecular formula C19H13Cl2N5O3 and a molecular weight of 430.25 g/mol. Its IUPAC name is [2-[[3-chloro-4-[1-(4-chlorophenyl)-1-cyanoethyl]phenyl]hydrazinylidene]-2-cyanoacetyl]carbamic acid.
| Compound Name | [2-[[3-chloro-4-[1-(4-chlorophenyl)-1-cyanoethyl]phenyl]hydrazinylidene]-2-cyanoacetyl]carbamic acid |
|---|---|
| PubChem CID | 173389699 |
| Molecular Formula | C19H13Cl2N5O3 |
| Molecular Weight | 430.25 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | [2-[[3-chloro-4-[1-(4-chlorophenyl)-1-cyanoethyl]phenyl]hydrazinylidene]-2-cyanoacetyl]carbamic acid |
| SMILES | CC(C#N)(c1ccc(Cl)cc1)c1ccc(NN=C(C#N)C(=O)NC(=O)O)cc1Cl |
| InChI | InChI=1S/C19H13Cl2N5O3/c1-19(10-23,11-2-4-12(20)5-3-11)14-7-6-13(8-15(14)21)25-26-16(9-22)17(27)24-18(28)29/h2-8,25H,1H3,(H,24,27)(H,28,29) |
| InChIKey | JDBCYJHGESHDFY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 138.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.25 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|