C10H6BrClN4O4 — CID 174215890
[2-[(3-bromo-5-chloro-4-deuteriooxyphenyl)hydrazinylidene]-2-cyanoacetyl]carbamic acid (PubChem CID 174215890) has the molecular formula C10H6BrClN4O4 and a molecular weight of 362.55 g/mol. Its IUPAC name is [2-[(3-bromo-5-chloro-4-deuteriooxyphenyl)hydrazinylidene]-2-cyanoacetyl]carbamic acid.
| Compound Name | [2-[(3-bromo-5-chloro-4-deuteriooxyphenyl)hydrazinylidene]-2-cyanoacetyl]carbamic acid |
|---|---|
| PubChem CID | 174215890 |
| Molecular Formula | C10H6BrClN4O4 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 360.93 |
| IUPAC Name | [2-[(3-bromo-5-chloro-4-deuteriooxyphenyl)hydrazinylidene]-2-cyanoacetyl]carbamic acid |
| SMILES | [2H]Oc1c(Cl)cc(NN=C(C#N)C(=O)NC(=O)O)cc1Br |
| InChI | InChI=1S/C10H6BrClN4O4/c11-5-1-4(2-6(12)8(5)17)15-16-7(3-13)9(18)14-10(19)20/h1-2,15,17H,(H,14,18)(H,19,20)/i/hD |
| InChIKey | CYZXJAHMLQKNCH-DYCDLGHISA-N |
| XLogP | 1.89 |
| TPSA | 134.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|