C20H13Cl3N8O5 — CID 155268357
[(2Z)-2-cyano-2-[[3,5-dichloro-4-[6-chloro-5-[(6-methoxypyridazin-3-yl)methyl]pyridazin-3-yl]oxyphenyl]hydrazinylidene]acetyl]carbamic acid (PubChem CID 155268357) has the molecular formula C20H13Cl3N8O5 and a molecular weight of 551.73 g/mol. Its IUPAC name is [(2Z)-2-cyano-2-[[3,5-dichloro-4-[6-chloro-5-[(6-methoxypyridazin-3-yl)methyl]pyridazin-3-yl]oxyphenyl]hydrazinylidene]acetyl]carbamic acid.
| Compound Name | [(2Z)-2-cyano-2-[[3,5-dichloro-4-[6-chloro-5-[(6-methoxypyridazin-3-yl)methyl]pyridazin-3-yl]oxyphenyl]hydrazinylidene]acetyl]carbamic acid |
|---|---|
| PubChem CID | 155268357 |
| Molecular Formula | C20H13Cl3N8O5 |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 550.01 |
| IUPAC Name | [(2Z)-2-cyano-2-[[3,5-dichloro-4-[6-chloro-5-[(6-methoxypyridazin-3-yl)methyl]pyridazin-3-yl]oxyphenyl]hydrazinylidene]acetyl]carbamic acid |
| SMILES | COc1ccc(Cc2cc(Oc3c(Cl)cc(N/N=C(/C#N)C(=O)NC(=O)O)cc3Cl)nnc2Cl)nn1 |
| InChI | InChI=1S/C20H13Cl3N8O5/c1-35-15-3-2-10(26-29-15)4-9-5-16(30-31-18(9)23)36-17-12(21)6-11(7-13(17)22)27-28-14(8-24)19(32)25-20(33)34/h2-3,5-7,27H,4H2,1H3,(H,25,32)(H,33,34)/b28-14- |
| InChIKey | RQUZRMHEQUMAQQ-MUXKCCDJSA-N |
| XLogP | 3.70 |
| TPSA | 184.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|