C22H23F3N4OS — CID 173396920
1-(1-cyclohexa-2,5-dien-1-yl-6-propoxypyridazin-4-ylidene)-3-[[3-(trifluoromethyl)phenyl]methyl]thiourea (PubChem CID 173396920) has the molecular formula C22H23F3N4OS and a molecular weight of 448.51 g/mol. Its IUPAC name is 1-(1-cyclohexa-2,5-dien-1-yl-6-propoxypyridazin-4-ylidene)-3-[[3-(trifluoromethyl)phenyl]methyl]thiourea.
| Compound Name | 1-(1-cyclohexa-2,5-dien-1-yl-6-propoxypyridazin-4-ylidene)-3-[[3-(trifluoromethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 173396920 |
| Molecular Formula | C22H23F3N4OS |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 1-(1-cyclohexa-2,5-dien-1-yl-6-propoxypyridazin-4-ylidene)-3-[[3-(trifluoromethyl)phenyl]methyl]thiourea |
| SMILES | CCCOc1cc(=NC(=S)NCc2cccc(C(F)(F)F)c2)cnn1C1C=CCC=C1 |
| InChI | InChI=1S/C22H23F3N4OS/c1-2-11-30-20-13-18(15-27-29(20)19-9-4-3-5-10-19)28-21(31)26-14-16-7-6-8-17(12-16)22(23,24)25/h4-10,12-13,15,19H,2-3,11,14H2,1H3,(H,26,31) |
| InChIKey | NXXJPTQYKWPCBD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|