C20H29N5O2S — CID 173399722
1-oxido-4-[3-[(5-piperidin-1-yl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]propylimino]-1,2,5-thiadiazol-1-ium-3-amine (PubChem CID 173399722) has the molecular formula C20H29N5O2S and a molecular weight of 403.55 g/mol. Its IUPAC name is 1-oxido-4-[3-[(5-piperidin-1-yl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]propylimino]-1,2,5-thiadiazol-1-ium-3-amine.
| Compound Name | 1-oxido-4-[3-[(5-piperidin-1-yl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]propylimino]-1,2,5-thiadiazol-1-ium-3-amine |
|---|---|
| PubChem CID | 173399722 |
| Molecular Formula | C20H29N5O2S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 1-oxido-4-[3-[(5-piperidin-1-yl-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]propylimino]-1,2,5-thiadiazol-1-ium-3-amine |
| SMILES | Nc1n[s+]([O-])[nH]/c1=N\CCCOc1cccc2c1CCCC2N1CCCCC1 |
| InChI | InChI=1S/C20H29N5O2S/c21-19-20(24-28(26)23-19)22-11-6-14-27-18-10-5-7-15-16(18)8-4-9-17(15)25-12-2-1-3-13-25/h5,7,10,17H,1-4,6,8-9,11-14H2,(H2,21,23)(H,22,24) |
| InChIKey | FRUJCLYBUHOOJF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|