C11H21N3O4 — CID 173401855
6-amino-N-(1-amino-3-hydroxy-1-oxobutan-2-yl)-2-formylhexanamide (PubChem CID 173401855) has the molecular formula C11H21N3O4 and a molecular weight of 259.31 g/mol. Its IUPAC name is 6-amino-N-(1-amino-3-hydroxy-1-oxobutan-2-yl)-2-formylhexanamide.
| Compound Name | 6-amino-N-(1-amino-3-hydroxy-1-oxobutan-2-yl)-2-formylhexanamide |
|---|---|
| PubChem CID | 173401855 |
| Molecular Formula | C11H21N3O4 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 6-amino-N-(1-amino-3-hydroxy-1-oxobutan-2-yl)-2-formylhexanamide |
| SMILES | CC(O)C(NC(=O)C(C=O)CCCCN)C(N)=O |
| InChI | InChI=1S/C11H21N3O4/c1-7(16)9(10(13)17)14-11(18)8(6-15)4-2-3-5-12/h6-9,16H,2-5,12H2,1H3,(H2,13,17)(H,14,18) |
| InChIKey | UDSMSAIXELVTED-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|