C34H46O6Si — CID 173404005
dimethyl 2-(6-diphenylsilyloxy-7,7-dimethylocta-2,4-dienyl)-2-(6-hydroxy-3-methylhex-3-enyl)propanedioate (PubChem CID 173404005) has the molecular formula C34H46O6Si and a molecular weight of 578.82 g/mol. Its IUPAC name is dimethyl 2-(6-diphenylsilyloxy-7,7-dimethylocta-2,4-dienyl)-2-(6-hydroxy-3-methylhex-3-enyl)propanedioate.
| Compound Name | dimethyl 2-(6-diphenylsilyloxy-7,7-dimethylocta-2,4-dienyl)-2-(6-hydroxy-3-methylhex-3-enyl)propanedioate |
|---|---|
| PubChem CID | 173404005 |
| Molecular Formula | C34H46O6Si |
| Molecular Weight | 578.82 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | dimethyl 2-(6-diphenylsilyloxy-7,7-dimethylocta-2,4-dienyl)-2-(6-hydroxy-3-methylhex-3-enyl)propanedioate |
| SMILES | COC(=O)C(CC=CC=CC(O[SiH](c1ccccc1)c1ccccc1)C(C)(C)C)(CCC(C)=CCCO)C(=O)OC |
| InChI | InChI=1S/C34H46O6Si/c1-27(17-16-26-35)23-25-34(31(36)38-5,32(37)39-6)24-15-9-14-22-30(33(2,3)4)40-41(28-18-10-7-11-19-28)29-20-12-8-13-21-29/h7-15,17-22,30,35,41H,16,23-26H2,1-6H3 |
| InChIKey | JFTNWPMSJLUDEA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.82 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|