About S-phenoxy N-phenoxysulfanylcarbonylcarbamothioate
S-phenoxy N-phenoxysulfanylcarbonylcarbamothioate (PubChem CID 173405515) has the molecular formula C14H11NO4S2
and a molecular weight of 321.38 g/mol. Its IUPAC name is S-phenoxy N-phenoxysulfanylcarbonylcarbamothioate.
Molecular Properties
| Compound Name | S-phenoxy N-phenoxysulfanylcarbonylcarbamothioate |
| PubChem CID | 173405515 |
| Molecular Formula | C14H11NO4S2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | S-phenoxy N-phenoxysulfanylcarbonylcarbamothioate |
| SMILES | O=C(NC(=O)SOc1ccccc1)SOc1ccccc1 |
| InChI | InChI=1S/C14H11NO4S2/c16-13(20-18-11-7-3-1-4-8-11)15-14(17)21-19-12-9-5-2-6-10-12/h1-10H,(H,15,16,17) |
| InChIKey | FQWMZXQYPWJGLO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-phenoxy N-phenoxysulfanylcarbonylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-phenoxy N-phenoxysulfanylcarbonylcarbamothioate?
The IUPAC name of S-phenoxy N-phenoxysulfanylcarbonylcarbamothioate (CID 173405515) is S-phenoxy N-phenoxysulfanylcarbonylcarbamothioate.
What is the SMILES notation for S-phenoxy N-phenoxysulfanylcarbonylcarbamothioate?
The canonical SMILES for S-phenoxy N-phenoxysulfanylcarbonylcarbamothioate is O=C(NC(=O)SOc1ccccc1)SOc1ccccc1.
What is the InChIKey of S-phenoxy N-phenoxysulfanylcarbonylcarbamothioate?
The InChIKey is FQWMZXQYPWJGLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO4S2/c16-13(20-18-11-7-3-1-4-8-11)15-14(17)21-19-12-9-5-2-6-10-12/h1-10H,(H,15,16,17).
What are the key properties of S-phenoxy N-phenoxysulfanylcarbonylcarbamothioate?
S-phenoxy N-phenoxysulfanylcarbonylcarbamothioate has a molecular weight of 321.38 g/mol, XLogP of 4.27, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-phenoxy N-phenoxysulfanylcarbonylcarbamothioate is sourced from PubChem (CID 173405515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).