C17H26NNaO5 — CID 173408715
sodium;hydride;methyl 2,2-dimethyl-4,6-dioxo-5-[4-(prop-2-enoxyamino)butylidene]cyclohexane-1-carboxylate (PubChem CID 173408715) has the molecular formula C17H26NNaO5 and a molecular weight of 347.39 g/mol. Its IUPAC name is sodium;hydride;methyl 2,2-dimethyl-4,6-dioxo-5-[4-(prop-2-enoxyamino)butylidene]cyclohexane-1-carboxylate.
| Compound Name | sodium;hydride;methyl 2,2-dimethyl-4,6-dioxo-5-[4-(prop-2-enoxyamino)butylidene]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 173408715 |
| Molecular Formula | C17H26NNaO5 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | sodium;hydride;methyl 2,2-dimethyl-4,6-dioxo-5-[4-(prop-2-enoxyamino)butylidene]cyclohexane-1-carboxylate |
| SMILES | C=CCONCCCC=C1C(=O)CC(C)(C)C(C(=O)OC)C1=O.[H-].[Na+] |
| InChI | InChI=1S/C17H25NO5.Na.H/c1-5-10-23-18-9-7-6-8-12-13(19)11-17(2,3)14(15(12)20)16(21)22-4;;/h5,8,14,18H,1,6-7,9-11H2,2-4H3;;/q;+1;-1 |
| InChIKey | FPSWUAHEORJYMX-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|