C6H9Na3O7S — CID 173411009
trisodium;3-hydroxy-2-methylidenepentanoate;sulfate (PubChem CID 173411009) has the molecular formula C6H9Na3O7S and a molecular weight of 294.17 g/mol. Its IUPAC name is trisodium;3-hydroxy-2-methylidenepentanoate;sulfate.
| Compound Name | trisodium;3-hydroxy-2-methylidenepentanoate;sulfate |
|---|---|
| PubChem CID | 173411009 |
| Molecular Formula | C6H9Na3O7S |
| Molecular Weight | 294.17 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | trisodium;3-hydroxy-2-methylidenepentanoate;sulfate |
| SMILES | C=C(C(=O)[O-])C(O)CC.O=S(=O)([O-])[O-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C6H10O3.3Na.H2O4S/c1-3-5(7)4(2)6(8)9;;;;1-5(2,3)4/h5,7H,2-3H2,1H3,(H,8,9);;;;(H2,1,2,3,4)/q;3*+1;/p-3 |
| InChIKey | XHXWCGDLIUVFRR-UHFFFAOYSA-K |
| XLogP | -11.26 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.17 |
| LogP ≤ 5 | -11.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|