C44H66N4O14 — CID 173411924
bis(methyl 4-[acetyl-[(2-methoxyphenyl)methoxy]amino]-1-(2-methylpropyl)piperidine-4-carboxylate);oxalic acid (PubChem CID 173411924) has the molecular formula C44H66N4O14 and a molecular weight of 875.03 g/mol. Its IUPAC name is bis(methyl 4-[acetyl-[(2-methoxyphenyl)methoxy]amino]-1-(2-methylpropyl)piperidine-4-carboxylate);oxalic acid.
| Compound Name | bis(methyl 4-[acetyl-[(2-methoxyphenyl)methoxy]amino]-1-(2-methylpropyl)piperidine-4-carboxylate);oxalic acid |
|---|---|
| PubChem CID | 173411924 |
| Molecular Formula | C44H66N4O14 |
| Molecular Weight | 875.03 g/mol |
| Exact Mass | 874.46 |
| IUPAC Name | bis(methyl 4-[acetyl-[(2-methoxyphenyl)methoxy]amino]-1-(2-methylpropyl)piperidine-4-carboxylate);oxalic acid |
| SMILES | COC(=O)C1(N(OCc2ccccc2OC)C(C)=O)CCN(CC(C)C)CC1.COC(=O)C1(N(OCc2ccccc2OC)C(C)=O)CCN(CC(C)C)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/2C21H32N2O5.C2H2O4/c2*1-16(2)14-22-12-10-21(11-13-22,20(25)27-5)23(17(3)24)28-15-18-8-6-7-9-19(18)26-4;3-1(4)2(5)6/h2*6-9,16H,10-15H2,1-5H3;(H,3,4)(H,5,6) |
| InChIKey | KDGMYQCABNWNPJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 211.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.03 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|