C24H34N6O10 — CID 88677091
methyl 4-[acetyl-[(2-methoxyphenyl)methoxy]amino]-1-[2-(4-ethyl-5-oxotetrazol-1-yl)ethyl]piperidine-4-carboxylate;oxalic acid (PubChem CID 88677091) has the molecular formula C24H34N6O10 and a molecular weight of 566.57 g/mol. Its IUPAC name is methyl 4-[acetyl-[(2-methoxyphenyl)methoxy]amino]-1-[2-(4-ethyl-5-oxotetrazol-1-yl)ethyl]piperidine-4-carboxylate;oxalic acid.
| Compound Name | methyl 4-[acetyl-[(2-methoxyphenyl)methoxy]amino]-1-[2-(4-ethyl-5-oxotetrazol-1-yl)ethyl]piperidine-4-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 88677091 |
| Molecular Formula | C24H34N6O10 |
| Molecular Weight | 566.57 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | methyl 4-[acetyl-[(2-methoxyphenyl)methoxy]amino]-1-[2-(4-ethyl-5-oxotetrazol-1-yl)ethyl]piperidine-4-carboxylate;oxalic acid |
| SMILES | CCn1nnn(CCN2CCC(C(=O)OC)(N(OCc3ccccc3OC)C(C)=O)CC2)c1=O.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H32N6O6.C2H2O4/c1-5-26-21(31)27(24-23-26)15-14-25-12-10-22(11-13-25,20(30)33-4)28(17(2)29)34-16-18-8-6-7-9-19(18)32-3;3-1(4)2(5)6/h6-9H,5,10-16H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | FUCWVBVRDGLYSC-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 195.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.57 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|