C48H62N4O14S2 — CID 23324782
bis(methyl 4-[acetyl-[(2-methoxyphenyl)methoxy]amino]-1-(2-thiophen-3-ylethyl)piperidin-1-ium-4-carboxylate);oxalate (PubChem CID 23324782) has the molecular formula C48H62N4O14S2 and a molecular weight of 983.17 g/mol. Its IUPAC name is bis(methyl 4-[acetyl-[(2-methoxyphenyl)methoxy]amino]-1-(2-thiophen-3-ylethyl)piperidin-1-ium-4-carboxylate);oxalate.
| Compound Name | bis(methyl 4-[acetyl-[(2-methoxyphenyl)methoxy]amino]-1-(2-thiophen-3-ylethyl)piperidin-1-ium-4-carboxylate);oxalate |
|---|---|
| PubChem CID | 23324782 |
| Molecular Formula | C48H62N4O14S2 |
| Molecular Weight | 983.17 g/mol |
| Exact Mass | 982.37 |
| IUPAC Name | bis(methyl 4-[acetyl-[(2-methoxyphenyl)methoxy]amino]-1-(2-thiophen-3-ylethyl)piperidin-1-ium-4-carboxylate);oxalate |
| SMILES | COC(=O)C1(N(OCc2ccccc2OC)C(C)=O)CC[NH+](CCc2ccsc2)CC1.COC(=O)C1(N(OCc2ccccc2OC)C(C)=O)CC[NH+](CCc2ccsc2)CC1.O=C([O-])C(=O)[O-] |
| InChI | InChI=1S/2C23H30N2O5S.C2H2O4/c2*1-18(26)25(30-16-20-6-4-5-7-21(20)28-2)23(22(27)29-3)10-13-24(14-11-23)12-8-19-9-15-31-17-19;3-1(4)2(5)6/h2*4-7,9,15,17H,8,10-14,16H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | RYCOUQPYBPNDCE-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 219.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 983.17 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|