C48H60N4O14S2+2 — CID 57005754
bis[4-[acetyl-[(2-methoxyphenyl)methoxy]amino]-4-methoxycarbonyl-1-(2-thiophen-3-ylethyl)piperidin-1-ium-1-yl] oxalate (PubChem CID 57005754) has the molecular formula C48H60N4O14S2+2 and a molecular weight of 981.16 g/mol. Its IUPAC name is bis[4-[acetyl-[(2-methoxyphenyl)methoxy]amino]-4-methoxycarbonyl-1-(2-thiophen-3-ylethyl)piperidin-1-ium-1-yl] oxalate.
| Compound Name | bis[4-[acetyl-[(2-methoxyphenyl)methoxy]amino]-4-methoxycarbonyl-1-(2-thiophen-3-ylethyl)piperidin-1-ium-1-yl] oxalate |
|---|---|
| PubChem CID | 57005754 |
| Molecular Formula | C48H60N4O14S2+2 |
| Molecular Weight | 981.16 g/mol |
| Exact Mass | 980.35 |
| IUPAC Name | bis[4-[acetyl-[(2-methoxyphenyl)methoxy]amino]-4-methoxycarbonyl-1-(2-thiophen-3-ylethyl)piperidin-1-ium-1-yl] oxalate |
| SMILES | COC(=O)C1(N(OCc2ccccc2OC)C(C)=O)CC[N+](CCc2ccsc2)(OC(=O)C(=O)O[N+]2(CCc3ccsc3)CCC(C(=O)OC)(N(OCc3ccccc3OC)C(C)=O)CC2)CC1 |
| InChI | InChI=1S/C48H60N4O14S2/c1-35(53)49(63-31-39-11-7-9-13-41(39)59-3)47(45(57)61-5)19-25-51(26-20-47,23-15-37-17-29-67-33-37)65-43(55)44(56)66-52(24-16-38-18-30-68-34-38)27-21-48(22-28-52,46(58)62-6)50(36(2)54)64-32-40-12-8-10-14-42(40)60-4/h7-14,17-18,29-30,33-34H,15-16,19-28,31-32H2,1-6H3/q+2 |
| InChIKey | NBBOFBUIHVITLW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 182.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 981.16 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|