C28H32N2O4S — CID 23324776
benzyl 4-[acetyl(phenylmethoxy)amino]-1-(2-thiophen-2-ylethyl)piperidine-4-carboxylate (PubChem CID 23324776) has the molecular formula C28H32N2O4S and a molecular weight of 492.64 g/mol. Its IUPAC name is benzyl 4-[acetyl(phenylmethoxy)amino]-1-(2-thiophen-2-ylethyl)piperidine-4-carboxylate.
| Compound Name | benzyl 4-[acetyl(phenylmethoxy)amino]-1-(2-thiophen-2-ylethyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 23324776 |
| Molecular Formula | C28H32N2O4S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | benzyl 4-[acetyl(phenylmethoxy)amino]-1-(2-thiophen-2-ylethyl)piperidine-4-carboxylate |
| SMILES | CC(=O)N(OCc1ccccc1)C1(C(=O)OCc2ccccc2)CCN(CCc2cccs2)CC1 |
| InChI | InChI=1S/C28H32N2O4S/c1-23(31)30(34-22-25-11-6-3-7-12-25)28(27(32)33-21-24-9-4-2-5-10-24)15-18-29(19-16-28)17-14-26-13-8-20-35-26/h2-13,20H,14-19,21-22H2,1H3 |
| InChIKey | WKIHVFDDYWIKBY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|