C27H34N2O8 — CID 88677030
methyl 4-[acetyl(phenylmethoxy)amino]-1-(2-phenylpropyl)piperidine-4-carboxylate;oxalic acid (PubChem CID 88677030) has the molecular formula C27H34N2O8 and a molecular weight of 514.58 g/mol. Its IUPAC name is methyl 4-[acetyl(phenylmethoxy)amino]-1-(2-phenylpropyl)piperidine-4-carboxylate;oxalic acid.
| Compound Name | methyl 4-[acetyl(phenylmethoxy)amino]-1-(2-phenylpropyl)piperidine-4-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 88677030 |
| Molecular Formula | C27H34N2O8 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | methyl 4-[acetyl(phenylmethoxy)amino]-1-(2-phenylpropyl)piperidine-4-carboxylate;oxalic acid |
| SMILES | COC(=O)C1(N(OCc2ccccc2)C(C)=O)CCN(CC(C)c2ccccc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H32N2O4.C2H2O4/c1-20(23-12-8-5-9-13-23)18-26-16-14-25(15-17-26,24(29)30-3)27(21(2)28)31-19-22-10-6-4-7-11-22;3-1(4)2(5)6/h4-13,20H,14-19H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | VEAVZZUKXMBSRE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|