C46H68N4O14+2 — CID 57251439
bis[4-[acetyl-[(2-methoxyphenyl)methoxy]amino]-4-methoxycarbonyl-1-(3-methylbutyl)piperidin-1-ium-1-yl] oxalate (PubChem CID 57251439) has the molecular formula C46H68N4O14+2 and a molecular weight of 901.06 g/mol. Its IUPAC name is bis[4-[acetyl-[(2-methoxyphenyl)methoxy]amino]-4-methoxycarbonyl-1-(3-methylbutyl)piperidin-1-ium-1-yl] oxalate.
| Compound Name | bis[4-[acetyl-[(2-methoxyphenyl)methoxy]amino]-4-methoxycarbonyl-1-(3-methylbutyl)piperidin-1-ium-1-yl] oxalate |
|---|---|
| PubChem CID | 57251439 |
| Molecular Formula | C46H68N4O14+2 |
| Molecular Weight | 901.06 g/mol |
| Exact Mass | 900.47 |
| IUPAC Name | bis[4-[acetyl-[(2-methoxyphenyl)methoxy]amino]-4-methoxycarbonyl-1-(3-methylbutyl)piperidin-1-ium-1-yl] oxalate |
| SMILES | COC(=O)C1(N(OCc2ccccc2OC)C(C)=O)CC[N+](CCC(C)C)(OC(=O)C(=O)O[N+]2(CCC(C)C)CCC(C(=O)OC)(N(OCc3ccccc3OC)C(C)=O)CC2)CC1 |
| InChI | InChI=1S/C46H68N4O14/c1-33(2)19-25-49(27-21-45(22-28-49,43(55)59-9)47(35(5)51)61-31-37-15-11-13-17-39(37)57-7)63-41(53)42(54)64-50(26-20-34(3)4)29-23-46(24-30-50,44(56)60-10)48(36(6)52)62-32-38-16-12-14-18-40(38)58-8/h11-18,33-34H,19-32H2,1-10H3/q+2 |
| InChIKey | FSJFIIDAELUJPJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 182.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.06 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|