C13H17N2O5P — CID 173413091
dihydrogen phosphate;2-(3-methylimidazol-3-ium-1-yl)-1-(3-methylphenyl)ethanone (PubChem CID 173413091) has the molecular formula C13H17N2O5P and a molecular weight of 312.26 g/mol. Its IUPAC name is dihydrogen phosphate;2-(3-methylimidazol-3-ium-1-yl)-1-(3-methylphenyl)ethanone.
| Compound Name | dihydrogen phosphate;2-(3-methylimidazol-3-ium-1-yl)-1-(3-methylphenyl)ethanone |
|---|---|
| PubChem CID | 173413091 |
| Molecular Formula | C13H17N2O5P |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | dihydrogen phosphate;2-(3-methylimidazol-3-ium-1-yl)-1-(3-methylphenyl)ethanone |
| SMILES | Cc1cccc(C(=O)Cn2cc[n+](C)c2)c1.O=P([O-])(O)O |
| InChI | InChI=1S/C13H15N2O.H3O4P/c1-11-4-3-5-12(8-11)13(16)9-15-7-6-14(2)10-15;1-5(2,3)4/h3-8,10H,9H2,1-2H3;(H3,1,2,3,4)/q+1;/p-1 |
| InChIKey | YXVJUFJVTQVZCU-UHFFFAOYSA-M |
| XLogP | -0.06 |
| TPSA | 106.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|