C11H27N3O4S2 — CID 173415903
bis(carbamothioic S-acid);N,N-dimethylpropan-1-amine;propan-2-yl formate (PubChem CID 173415903) has the molecular formula C11H27N3O4S2 and a molecular weight of 329.49 g/mol. Its IUPAC name is bis(carbamothioic S-acid);N,N-dimethylpropan-1-amine;propan-2-yl formate.
| Compound Name | bis(carbamothioic S-acid);N,N-dimethylpropan-1-amine;propan-2-yl formate |
|---|---|
| PubChem CID | 173415903 |
| Molecular Formula | C11H27N3O4S2 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | bis(carbamothioic S-acid);N,N-dimethylpropan-1-amine;propan-2-yl formate |
| SMILES | CC(C)OC=O.CCCN(C)C.NC(=O)S.NC(=O)S |
| InChI | InChI=1S/C5H13N.C4H8O2.2CH3NOS/c1-4-5-6(2)3;1-4(2)6-3-5;2*2-1(3)4/h4-5H2,1-3H3;3-4H,1-2H3;2*(H3,2,3,4) |
| InChIKey | QRRJWTWZVIAPBY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|