About carbonic acid;1-hydroperoxybutane;3-(hydroperoxymethyl)heptane
carbonic acid;1-hydroperoxybutane;3-(hydroperoxymethyl)heptane (PubChem CID 173419289) has the molecular formula C16H36O16
and a molecular weight of 484.45 g/mol. Its IUPAC name is carbonic acid;1-hydroperoxybutane;3-(hydroperoxymethyl)heptane.
Molecular Properties
| Compound Name | carbonic acid;1-hydroperoxybutane;3-(hydroperoxymethyl)heptane |
| PubChem CID | 173419289 |
| Molecular Formula | C16H36O16 |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | carbonic acid;1-hydroperoxybutane;3-(hydroperoxymethyl)heptane |
| SMILES | CCCCC(CC)COO.CCCCOO.O=C(O)O.O=C(O)O.O=C(O)O.O=C(O)O |
| InChI | InChI=1S/C8H18O2.C4H10O2.4CH2O3/c1-3-5-6-8(4-2)7-10-9;1-2-3-4-6-5;4*2-1(3)4/h8-9H,3-7H2,1-2H3;5H,2-4H2,1H3;4*(H2,2,3,4) |
| InChIKey | WRYYSKBLPXYEFT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 289.04 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze carbonic acid;1-hydroperoxybutane;3-(hydroperoxymethyl)heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;1-hydroperoxybutane;3-(hydroperoxymethyl)heptane?
The IUPAC name of carbonic acid;1-hydroperoxybutane;3-(hydroperoxymethyl)heptane (CID 173419289) is carbonic acid;1-hydroperoxybutane;3-(hydroperoxymethyl)heptane.
What is the SMILES notation for carbonic acid;1-hydroperoxybutane;3-(hydroperoxymethyl)heptane?
The canonical SMILES for carbonic acid;1-hydroperoxybutane;3-(hydroperoxymethyl)heptane is CCCCC(CC)COO.CCCCOO.O=C(O)O.O=C(O)O.O=C(O)O.O=C(O)O.
What is the InChIKey of carbonic acid;1-hydroperoxybutane;3-(hydroperoxymethyl)heptane?
The InChIKey is WRYYSKBLPXYEFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2.C4H10O2.4CH2O3/c1-3-5-6-8(4-2)7-10-9;1-2-3-4-6-5;4*2-1(3)4/h8-9H,3-7H2,1-2H3;5H,2-4H2,1H3;4*(H2,2,3,4).
What are the key properties of carbonic acid;1-hydroperoxybutane;3-(hydroperoxymethyl)heptane?
carbonic acid;1-hydroperoxybutane;3-(hydroperoxymethyl)heptane has a molecular weight of 484.45 g/mol, XLogP of 4.86, 9 rotatable bonds, 10 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;1-hydroperoxybutane;3-(hydroperoxymethyl)heptane is sourced from PubChem (CID 173419289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).