C26H52O4Si2 — CID 173421031
methyl 6-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]hept-6-enoate (PubChem CID 173421031) has the molecular formula C26H52O4Si2 and a molecular weight of 484.87 g/mol. Its IUPAC name is methyl 6-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]hept-6-enoate.
| Compound Name | methyl 6-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]hept-6-enoate |
|---|---|
| PubChem CID | 173421031 |
| Molecular Formula | C26H52O4Si2 |
| Molecular Weight | 484.87 g/mol |
| Exact Mass | 484.34 |
| IUPAC Name | methyl 6-[(1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclopentyl]hept-6-enoate |
| SMILES | C=C(CCCCC(=O)OC)[C@@H]1CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H52O4Si2/c1-20(15-13-14-16-24(27)28-8)21-17-18-23(30-32(11,12)26(5,6)7)22(21)19-29-31(9,10)25(2,3)4/h21-23H,1,13-19H2,2-12H3/t21-,22+,23-/m0/s1 |
| InChIKey | CHIQTSJHTIIQKD-ZRBLBEILSA-N |
| XLogP | 7.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.87 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|