About 5-oxo-4-phenylpyrazole-3-sulfonic acid;stilbene
5-oxo-4-phenylpyrazole-3-sulfonic acid;stilbene (PubChem CID 173422601) has the molecular formula C23H18N2O4S
and a molecular weight of 418.47 g/mol. Its IUPAC name is 5-oxo-4-phenylpyrazole-3-sulfonic acid;stilbene.
Molecular Properties
| Compound Name | 5-oxo-4-phenylpyrazole-3-sulfonic acid;stilbene |
| PubChem CID | 173422601 |
| Molecular Formula | C23H18N2O4S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 5-oxo-4-phenylpyrazole-3-sulfonic acid;stilbene |
| SMILES | C(=Cc1ccccc1)c1ccccc1.O=C1N=NC(S(=O)(=O)O)=C1c1ccccc1 |
| InChI | InChI=1S/C14H12.C9H6N2O4S/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;12-8-7(6-4-2-1-3-5-6)9(11-10-8)16(13,14)15/h1-12H;1-5H,(H,13,14,15) |
| InChIKey | PQNIPVOBMQEHIK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5-oxo-4-phenylpyrazole-3-sulfonic acid;stilbene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-4-phenylpyrazole-3-sulfonic acid;stilbene?
The IUPAC name of 5-oxo-4-phenylpyrazole-3-sulfonic acid;stilbene (CID 173422601) is 5-oxo-4-phenylpyrazole-3-sulfonic acid;stilbene.
What is the SMILES notation for 5-oxo-4-phenylpyrazole-3-sulfonic acid;stilbene?
The canonical SMILES for 5-oxo-4-phenylpyrazole-3-sulfonic acid;stilbene is C(=Cc1ccccc1)c1ccccc1.O=C1N=NC(S(=O)(=O)O)=C1c1ccccc1.
What is the InChIKey of 5-oxo-4-phenylpyrazole-3-sulfonic acid;stilbene?
The InChIKey is PQNIPVOBMQEHIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.C9H6N2O4S/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;12-8-7(6-4-2-1-3-5-6)9(11-10-8)16(13,14)15/h1-12H;1-5H,(H,13,14,15).
What are the key properties of 5-oxo-4-phenylpyrazole-3-sulfonic acid;stilbene?
5-oxo-4-phenylpyrazole-3-sulfonic acid;stilbene has a molecular weight of 418.47 g/mol, XLogP of 5.09, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-4-phenylpyrazole-3-sulfonic acid;stilbene is sourced from PubChem (CID 173422601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).