About stilbene;triazol-4-one
stilbene;triazol-4-one (PubChem CID 67742152) has the molecular formula C16H13N3O
and a molecular weight of 263.30 g/mol. Its IUPAC name is stilbene;triazol-4-one.
Molecular Properties
| Compound Name | stilbene;triazol-4-one |
| PubChem CID | 67742152 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | stilbene;triazol-4-one |
| SMILES | C(=Cc1ccccc1)c1ccccc1.O=C1C=NN=N1 |
| InChI | InChI=1S/C14H12.C2HN3O/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;6-2-1-3-5-4-2/h1-12H;1H |
| InChIKey | JYOVGMPFJGJTGO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 54.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze stilbene;triazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of stilbene;triazol-4-one?
The IUPAC name of stilbene;triazol-4-one (CID 67742152) is stilbene;triazol-4-one.
What is the SMILES notation for stilbene;triazol-4-one?
The canonical SMILES for stilbene;triazol-4-one is C(=Cc1ccccc1)c1ccccc1.O=C1C=NN=N1.
What is the InChIKey of stilbene;triazol-4-one?
The InChIKey is JYOVGMPFJGJTGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.C2HN3O/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;6-2-1-3-5-4-2/h1-12H;1H.
What are the key properties of stilbene;triazol-4-one?
stilbene;triazol-4-one has a molecular weight of 263.30 g/mol, XLogP of 3.82, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for stilbene;triazol-4-one is sourced from PubChem (CID 67742152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).