C15H26O — CID 173425396
3-(2-methyloctan-2-yl)cyclohexa-1,3-dien-1-ol (PubChem CID 173425396) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is 3-(2-methyloctan-2-yl)cyclohexa-1,3-dien-1-ol.
| Compound Name | 3-(2-methyloctan-2-yl)cyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 173425396 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 3-(2-methyloctan-2-yl)cyclohexa-1,3-dien-1-ol |
| SMILES | CCCCCCC(C)(C)C1=CCCC(O)=C1 |
| InChI | InChI=1S/C15H26O/c1-4-5-6-7-11-15(2,3)13-9-8-10-14(16)12-13/h9,12,16H,4-8,10-11H2,1-3H3 |
| InChIKey | GXSNCXOBWAUELJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|