C22H24O3Si — CID 173427825
4-[2-[4-[methyl(phenyl)silyl]peroxyphenyl]propan-2-yl]phenol (PubChem CID 173427825) has the molecular formula C22H24O3Si and a molecular weight of 364.52 g/mol. Its IUPAC name is 4-[2-[4-[methyl(phenyl)silyl]peroxyphenyl]propan-2-yl]phenol.
| Compound Name | 4-[2-[4-[methyl(phenyl)silyl]peroxyphenyl]propan-2-yl]phenol |
|---|---|
| PubChem CID | 173427825 |
| Molecular Formula | C22H24O3Si |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 4-[2-[4-[methyl(phenyl)silyl]peroxyphenyl]propan-2-yl]phenol |
| SMILES | C[SiH](OOc1ccc(C(C)(C)c2ccc(O)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H24O3Si/c1-22(2,17-9-13-19(23)14-10-17)18-11-15-20(16-12-18)24-25-26(3)21-7-5-4-6-8-21/h4-16,23,26H,1-3H3 |
| InChIKey | KCNCJXUVZSWVSJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|