C20H31NaO7S — CID 173429118
sodium;4,5-dihexyl-3-sulfophthalic acid;hydride (PubChem CID 173429118) has the molecular formula C20H31NaO7S and a molecular weight of 438.52 g/mol. Its IUPAC name is sodium;4,5-dihexyl-3-sulfophthalic acid;hydride.
| Compound Name | sodium;4,5-dihexyl-3-sulfophthalic acid;hydride |
|---|---|
| PubChem CID | 173429118 |
| Molecular Formula | C20H31NaO7S |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | sodium;4,5-dihexyl-3-sulfophthalic acid;hydride |
| SMILES | CCCCCCc1cc(C(=O)O)c(C(=O)O)c(S(=O)(=O)O)c1CCCCCC.[H-].[Na+] |
| InChI | InChI=1S/C20H30O7S.Na.H/c1-3-5-7-9-11-14-13-16(19(21)22)17(20(23)24)18(28(25,26)27)15(14)12-10-8-6-4-2;;/h13H,3-12H2,1-2H3,(H,21,22)(H,23,24)(H,25,26,27);;/q;+1;-1 |
| InChIKey | ABVIVTYSWPUXBL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|